C21H23NO2 — CID 171037749
N-cyclopentyl-4-ethenyl-2-phenylmethoxybenzamide (PubChem CID 171037749) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-cyclopentyl-4-ethenyl-2-phenylmethoxybenzamide.
| Compound Name | N-cyclopentyl-4-ethenyl-2-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 171037749 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-cyclopentyl-4-ethenyl-2-phenylmethoxybenzamide |
| SMILES | C=Cc1ccc(C(=O)NC2CCCC2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H23NO2/c1-2-16-12-13-19(21(23)22-18-10-6-7-11-18)20(14-16)24-15-17-8-4-3-5-9-17/h2-5,8-9,12-14,18H,1,6-7,10-11,15H2,(H,22,23) |
| InChIKey | MTXUWIYVFYWOFJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |