C19H34ClN — CID 171042964
decyl-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-dimethylazanium chloride (PubChem CID 171042964) has the molecular formula C19H34ClN and a molecular weight of 318.98 g/mol. Its IUPAC name is decyl-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-dimethylazanium chloride.
| Compound Name | decyl-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-dimethylazanium chloride |
|---|---|
| PubChem CID | 171042964 |
| Molecular Formula | C19H34ClN |
| Molecular Weight | 318.98 g/mol |
| Exact Mass | 318.28 |
| IUPAC Name | decyl-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-dimethylazanium chloride |
| SMILES | [2H]c1c([2H])c([2H])c(C([2H])([2H])[N+](C)(C)CCCCCCCCCC)c([2H])c1[2H].[Cl-] |
| InChI | InChI=1S/C19H34N.ClH/c1-4-5-6-7-8-9-10-14-17-20(2,3)18-19-15-12-11-13-16-19;/h11-13,15-16H,4-10,14,17-18H2,1-3H3;1H/q+1;/p-1/i11D,12D,13D,15D,16D,18D2; |
| InChIKey | TTZLKXKJIMOHHG-YQXXGYKQSA-M |
| XLogP | 2.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.98 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|