C17H30N+ — CID 171382401
[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-dimethyl-octylazanium (PubChem CID 171382401) has the molecular formula C17H30N+ and a molecular weight of 255.48 g/mol. Its IUPAC name is [dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-dimethyl-octylazanium.
| Compound Name | [dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-dimethyl-octylazanium |
|---|---|
| PubChem CID | 171382401 |
| Molecular Formula | C17H30N+ |
| Molecular Weight | 255.48 g/mol |
| Exact Mass | 255.28 |
| IUPAC Name | [dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-dimethyl-octylazanium |
| SMILES | [2H]c1c([2H])c([2H])c(C([2H])([2H])[N+](C)(C)CCCCCCCC)c([2H])c1[2H] |
| InChI | InChI=1S/C17H30N/c1-4-5-6-7-8-12-15-18(2,3)16-17-13-10-9-11-14-17/h9-11,13-14H,4-8,12,15-16H2,1-3H3/q+1/i9D,10D,11D,13D,14D,16D2 |
| InChIKey | SHFLYPPECXRCFO-UBTFMDKUSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|