C27H26N4OS — CID 17104304
(E)-N-[[5-(1H-benzimidazol-2-yl)-2-methylphenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 17104304) has the molecular formula C27H26N4OS and a molecular weight of 454.60 g/mol. Its IUPAC name is (E)-N-[[5-(1H-benzimidazol-2-yl)-2-methylphenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[5-(1H-benzimidazol-2-yl)-2-methylphenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17104304 |
| Molecular Formula | C27H26N4OS |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | (E)-N-[[5-(1H-benzimidazol-2-yl)-2-methylphenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(-c2nc3ccccc3[nH]2)cc1NC(=S)NC(=O)/C=C/c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C27H26N4OS/c1-17(2)20-13-9-19(10-14-20)11-15-25(32)31-27(33)30-24-16-21(12-8-18(24)3)26-28-22-6-4-5-7-23(22)29-26/h4-17H,1-3H3,(H,28,29)(H2,30,31,32,33)/b15-11+ |
| InChIKey | REFCAQSPPVXDTO-RVDMUPIBSA-N |
| XLogP | 6.19 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|