C28H29N4O2P — CID 171043117
1-(2-dimethylphosphorylphenyl)-5-ethynyl-2-[4-[(3R)-1-methylpyrrolidin-3-yl]oxyphenyl]pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 171043117) has the molecular formula C28H29N4O2P and a molecular weight of 484.54 g/mol. Its IUPAC name is 1-(2-dimethylphosphorylphenyl)-5-ethynyl-2-[4-[(3R)-1-methylpyrrolidin-3-yl]oxyphenyl]pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | 1-(2-dimethylphosphorylphenyl)-5-ethynyl-2-[4-[(3R)-1-methylpyrrolidin-3-yl]oxyphenyl]pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 171043117 |
| Molecular Formula | C28H29N4O2P |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 1-(2-dimethylphosphorylphenyl)-5-ethynyl-2-[4-[(3R)-1-methylpyrrolidin-3-yl]oxyphenyl]pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | C#Cc1cnc2c(cc(-c3ccc(O[C@@H]4CCN(C)C4)cc3)n2-c2ccccc2P(C)(C)=O)c1N |
| InChI | InChI=1S/C28H29N4O2P/c1-5-19-17-30-28-23(27(19)29)16-25(32(28)24-8-6-7-9-26(24)35(3,4)33)20-10-12-21(13-11-20)34-22-14-15-31(2)18-22/h1,6-13,16-17,22H,14-15,18H2,2-4H3,(H2,29,30)/t22-/m1/s1 |
| InChIKey | GQNNZCYBFQPGLU-JOCHJYFZSA-N |
| XLogP | 4.59 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|