C74H72N4O — CID 171046722
CID 171046722 (PubChem CID 171046722) has the molecular formula C74H72N4O and a molecular weight of 1038.45 g/mol.
| Compound Name | CID 171046722 |
|---|---|
| PubChem CID | 171046722 |
| Molecular Formula | C74H72N4O |
| Molecular Weight | 1038.45 g/mol |
| Exact Mass | 1037.60 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc3c4c(c2)n(-c2cccc(Oc5ccc6c7ccccc7n(-c7cc(C(C)(C)C)ccn7)c6c5)c2)[c-][n+]4-c2c(cc(C(C)(C)C)cc2C(C)(C)C)-c2cc4c(cc2-c2ccccc2-3)C(C)(C)CCC4(C)C)c([2H])c1[2H] |
| InChI | InChI=1S/C74H72N4O/c1-70(2,3)48-32-35-75-67(40-48)78-64-29-20-19-28-55(64)56-31-30-52(42-65(56)78)79-51-25-21-24-50(41-51)76-45-77-68-60(38-49(71(4,5)6)39-63(68)72(7,8)9)58-44-62-61(73(10,11)33-34-74(62,12)13)43-57(58)53-26-17-18-27-54(53)59-36-47(37-66(76)69(59)77)46-22-15-14-16-23-46/h14-32,35-44H,33-34H2,1-13H3/i14D,15D,16D,22D,23D |
| InChIKey | QQCLRVYDYXNWKE-ZGPQSFTESA-N |
| XLogP | 19.21 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1038.45 |
| LogP ≤ 5 | 19.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|