C86H65N5O — CID 171046644
CID 171046644 (PubChem CID 171046644) has the molecular formula C86H65N5O and a molecular weight of 1197.58 g/mol.
| Compound Name | CID 171046644 |
|---|---|
| PubChem CID | 171046644 |
| Molecular Formula | C86H65N5O |
| Molecular Weight | 1197.58 g/mol |
| Exact Mass | 1196.60 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c(-c3cc4c5c(c3)n(-c3cccc(Oc6ccc7c8ccccc8n(-c8cc(C(C)(C)C)ccn8)c7c6)c3)[c-][n+]5-c3c(cc(C(C)(C)C)cc3-n3c5ccccc5c5ccccc53)-c3ccccc3-c3ccccc3-4)c([2H])c(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C86H65N5O/c1-85(2,3)61-42-43-87-82(51-61)91-78-39-22-19-36-72(78)73-41-40-65(53-79(73)91)92-64-29-23-28-63(52-64)88-54-89-83-74(47-60(48-80(83)88)59-45-57(55-24-9-7-10-25-55)44-58(46-59)56-26-11-8-12-27-56)68-32-15-13-30-66(68)67-31-14-16-33-69(67)75-49-62(86(4,5)6)50-81(84(75)89)90-76-37-20-17-34-70(76)71-35-18-21-38-77(71)90/h7-53H,1-6H3/i7D,8D,9D,10D,11D,12D,24D,25D,26D,27D,44D,45D,46D |
| InChIKey | QVQCJFWTDDNKMD-UWASHZFGSA-N |
| XLogP | 22.00 |
| TPSA | 40.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1197.58 |
| LogP ≤ 5 | 22.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|