C82H73N5O — CID 171046932
CID 171046932 (PubChem CID 171046932) has the molecular formula C82H73N5O and a molecular weight of 1152.57 g/mol.
| Compound Name | CID 171046932 |
|---|---|
| PubChem CID | 171046932 |
| Molecular Formula | C82H73N5O |
| Molecular Weight | 1152.57 g/mol |
| Exact Mass | 1151.63 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])-c1cc(C(C)(C)C)cc(-n3c4ccccc4c4ccccc43)c1-[n+]1[c-]n(-c3cccc(Oc4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)c3)c3cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)cc(c31)-c1c([2H])c([2H])c([2H])c([2H])c1-2 |
| InChI | InChI=1S/C82H73N5O/c1-79(2,3)53-38-39-83-76(47-53)87-72-35-22-19-32-66(72)67-37-36-59(49-73(67)87)88-58-25-23-24-57(48-58)84-50-85-77-68(42-52(43-74(77)84)51-40-54(80(4,5)6)44-55(41-51)81(7,8)9)62-28-15-13-26-60(62)61-27-14-16-29-63(61)69-45-56(82(10,11)12)46-75(78(69)85)86-70-33-20-17-30-64(70)65-31-18-21-34-71(65)86/h13-49H,1-12H3/i13D,14D,15D,16D,26D,27D,28D,29D |
| InChIKey | DESZSUHUYJQFEW-DXWNEZAYSA-N |
| XLogP | 21.26 |
| TPSA | 40.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1152.57 |
| LogP ≤ 5 | 21.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|