C82H59N5OSi — CID 171047020
CID 171047020 (PubChem CID 171047020) has the molecular formula C82H59N5OSi and a molecular weight of 1173.59 g/mol.
| Compound Name | CID 171047020 |
|---|---|
| PubChem CID | 171047020 |
| Molecular Formula | C82H59N5OSi |
| Molecular Weight | 1173.59 g/mol |
| Exact Mass | 1172.54 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c([Si](c2cc3c4c(c2)n(-c2cccc(Oc5ccc6c7ccccc7n(-c7cc(C(C)(C)C)ccn7)c6c5)c2)[c-][n+]4-c2c(cccc2-n2c4ccccc4c4ccccc42)-c2ccccc2-c2ccccc2-3)(c2c([2H])c([2H])c([2H])c([2H])c2[2H])c2c([2H])c([2H])c([2H])c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C82H59N5OSi/c1-82(2,3)55-47-48-83-79(49-55)87-75-43-22-19-39-69(75)70-46-45-58(51-77(70)87)88-57-26-23-25-56(50-57)84-54-85-80-71(40-24-44-76(80)86-73-41-20-17-37-67(73)68-38-18-21-42-74(68)86)65-35-15-13-33-63(65)64-34-14-16-36-66(64)72-52-62(53-78(84)81(72)85)89(59-27-7-4-8-28-59,60-29-9-5-10-30-60)61-31-11-6-12-32-61/h4-53H,1-3H3/i4D,5D,6D,7D,8D,9D,10D,11D,12D,27D,28D,29D,30D,31D,32D |
| InChIKey | IHGKXJGYXBMZQM-ZIMOVJAZSA-N |
| XLogP | 17.08 |
| TPSA | 40.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 89 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1173.59 |
| LogP ≤ 5 | 17.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|