C18H19IN2O2S — CID 17104860
N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]-2-(2-methylphenoxy)acetamide (PubChem CID 17104860) has the molecular formula C18H19IN2O2S and a molecular weight of 454.33 g/mol. Its IUPAC name is N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]-2-(2-methylphenoxy)acetamide.
| Compound Name | N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]-2-(2-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 17104860 |
| Molecular Formula | C18H19IN2O2S |
| Molecular Weight | 454.33 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]-2-(2-methylphenoxy)acetamide |
| SMILES | Cc1cc(NC(=S)NC(=O)COc2ccccc2C)c(C)cc1I |
| InChI | InChI=1S/C18H19IN2O2S/c1-11-6-4-5-7-16(11)23-10-17(22)21-18(24)20-15-9-12(2)14(19)8-13(15)3/h4-9H,10H2,1-3H3,(H2,20,21,22,24) |
| InChIKey | HPVFUIPPURDGSD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|