C29H31ClFN7O3 — CID 171048713
2-[[4-[2-[(4-chlorophenyl)methyl]-5-fluoropyrimidin-4-yl]oxycyclohexyl]methyl]-N'-hydroxy-3-[[(2S)-oxetan-2-yl]methyl]imidazo[4,5-c]pyridine-6-carboximidamide (PubChem CID 171048713) has the molecular formula C29H31ClFN7O3 and a molecular weight of 580.06 g/mol. Its IUPAC name is 2-[[4-[2-[(4-chlorophenyl)methyl]-5-fluoropyrimidin-4-yl]oxycyclohexyl]methyl]-N'-hydroxy-3-[[(2S)-oxetan-2-yl]methyl]imidazo[4,5-c]pyridine-6-carboximidamide.
| Compound Name | 2-[[4-[2-[(4-chlorophenyl)methyl]-5-fluoropyrimidin-4-yl]oxycyclohexyl]methyl]-N'-hydroxy-3-[[(2S)-oxetan-2-yl]methyl]imidazo[4,5-c]pyridine-6-carboximidamide |
|---|---|
| PubChem CID | 171048713 |
| Molecular Formula | C29H31ClFN7O3 |
| Molecular Weight | 580.06 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | 2-[[4-[2-[(4-chlorophenyl)methyl]-5-fluoropyrimidin-4-yl]oxycyclohexyl]methyl]-N'-hydroxy-3-[[(2S)-oxetan-2-yl]methyl]imidazo[4,5-c]pyridine-6-carboximidamide |
| SMILES | N/C(=N\O)c1cc2nc(CC3CCC(Oc4nc(Cc5ccc(Cl)cc5)ncc4F)CC3)n(C[C@@H]3CCO3)c2cn1 |
| InChI | InChI=1S/C29H31ClFN7O3/c30-19-5-1-17(2-6-19)11-26-34-14-22(31)29(36-26)41-20-7-3-18(4-8-20)12-27-35-23-13-24(28(32)37-39)33-15-25(23)38(27)16-21-9-10-40-21/h1-2,5-6,13-15,18,20-21,39H,3-4,7-12,16H2,(H2,32,37)/t18?,20?,21-/m0/s1 |
| InChIKey | ZITATJMJJYKHBT-MNLRITNHSA-N |
| XLogP | 4.67 |
| TPSA | 133.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.06 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|