C29H31ClFN7O3 — CID 169090355
2-[[4-[2-[(4-chlorophenyl)methyl]pyrimidin-4-yl]oxypiperidin-1-yl]methyl]-6-fluoro-N'-hydroxy-1-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboximidamide (PubChem CID 169090355) has the molecular formula C29H31ClFN7O3 and a molecular weight of 580.06 g/mol. Its IUPAC name is 2-[[4-[2-[(4-chlorophenyl)methyl]pyrimidin-4-yl]oxypiperidin-1-yl]methyl]-6-fluoro-N'-hydroxy-1-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboximidamide.
| Compound Name | 2-[[4-[2-[(4-chlorophenyl)methyl]pyrimidin-4-yl]oxypiperidin-1-yl]methyl]-6-fluoro-N'-hydroxy-1-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 169090355 |
| Molecular Formula | C29H31ClFN7O3 |
| Molecular Weight | 580.06 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | 2-[[4-[2-[(4-chlorophenyl)methyl]pyrimidin-4-yl]oxypiperidin-1-yl]methyl]-6-fluoro-N'-hydroxy-1-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboximidamide |
| SMILES | NC(=NO)c1cc2nc(CN3CCC(Oc4ccnc(Cc5ccc(Cl)cc5)n4)CC3)n(C[C@@H]3CCO3)c2cc1F |
| InChI | InChI=1S/C29H31ClFN7O3/c30-19-3-1-18(2-4-19)13-26-33-9-5-28(35-26)41-20-6-10-37(11-7-20)17-27-34-24-14-22(29(32)36-39)23(31)15-25(24)38(27)16-21-8-12-40-21/h1-5,9,14-15,20-21,39H,6-8,10-13,16-17H2,(H2,32,36)/t21-/m0/s1 |
| InChIKey | KZEKJAAZRMYVEE-NRFANRHFSA-N |
| XLogP | 4.14 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.06 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|