C17H15BrFNO3S — CID 171048783
1-[[3-(bromomethyl)-2-fluoro-6H-benzo[c]chromen-8-yl]sulfonyl]azetidine (PubChem CID 171048783) has the molecular formula C17H15BrFNO3S and a molecular weight of 412.28 g/mol. Its IUPAC name is 1-[[3-(bromomethyl)-2-fluoro-6H-benzo[c]chromen-8-yl]sulfonyl]azetidine.
| Compound Name | 1-[[3-(bromomethyl)-2-fluoro-6H-benzo[c]chromen-8-yl]sulfonyl]azetidine |
|---|---|
| PubChem CID | 171048783 |
| Molecular Formula | C17H15BrFNO3S |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 1-[[3-(bromomethyl)-2-fluoro-6H-benzo[c]chromen-8-yl]sulfonyl]azetidine |
| SMILES | O=S(=O)(c1ccc2c(c1)COc1cc(CBr)c(F)cc1-2)N1CCC1 |
| InChI | InChI=1S/C17H15BrFNO3S/c18-9-11-7-17-15(8-16(11)19)14-3-2-13(6-12(14)10-23-17)24(21,22)20-4-1-5-20/h2-3,6-8H,1,4-5,9-10H2 |
| InChIKey | JYGSUFSQHINJLS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|