C12H14ClN5O2S — CID 171051463
2-chloro-5-methyl-1-oxidospiro[7H-purino[9,8-a]imidazol-1-ium-8,4'-thiane] 1'-oxide (PubChem CID 171051463) has the molecular formula C12H14ClN5O2S and a molecular weight of 327.80 g/mol. Its IUPAC name is 2-chloro-5-methyl-1-oxidospiro[7H-purino[9,8-a]imidazol-1-ium-8,4'-thiane] 1'-oxide.
| Compound Name | 2-chloro-5-methyl-1-oxidospiro[7H-purino[9,8-a]imidazol-1-ium-8,4'-thiane] 1'-oxide |
|---|---|
| PubChem CID | 171051463 |
| Molecular Formula | C12H14ClN5O2S |
| Molecular Weight | 327.80 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 2-chloro-5-methyl-1-oxidospiro[7H-purino[9,8-a]imidazol-1-ium-8,4'-thiane] 1'-oxide |
| SMILES | CN1C2=NCC3(CCS(=O)CC3)N2c2c1cnc(Cl)[n+]2[O-] |
| InChI | InChI=1S/C12H14ClN5O2S/c1-16-8-6-14-10(13)18(19)9(8)17-11(16)15-7-12(17)2-4-21(20)5-3-12/h6H,2-5,7H2,1H3 |
| InChIKey | RDGFPUGZAXHBRC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 75.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.80 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|