C12H14ClN5S — CID 167163649
2-chloro-5-methylspiro[7H-purino[9,8-a]imidazole-8,4'-thiane] (PubChem CID 167163649) has the molecular formula C12H14ClN5S and a molecular weight of 295.80 g/mol. Its IUPAC name is 2-chloro-5-methylspiro[7H-purino[9,8-a]imidazole-8,4'-thiane].
| Compound Name | 2-chloro-5-methylspiro[7H-purino[9,8-a]imidazole-8,4'-thiane] |
|---|---|
| PubChem CID | 167163649 |
| Molecular Formula | C12H14ClN5S |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-chloro-5-methylspiro[7H-purino[9,8-a]imidazole-8,4'-thiane] |
| SMILES | CN1C2=NCC3(CCSCC3)N2c2nc(Cl)ncc21 |
| InChI | InChI=1S/C12H14ClN5S/c1-17-8-6-14-10(13)16-9(8)18-11(17)15-7-12(18)2-4-19-5-3-12/h6H,2-5,7H2,1H3 |
| InChIKey | UVMWKVMGYTXXND-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 44.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |