C36H20F3N3O3S — CID 171054802
[1-(1,10-phenanthrolin-2-yl)-6-phenylbenzo[k]phenanthridin-7-yl] trifluoromethanesulfonate (PubChem CID 171054802) has the molecular formula C36H20F3N3O3S and a molecular weight of 631.64 g/mol. Its IUPAC name is [1-(1,10-phenanthrolin-2-yl)-6-phenylbenzo[k]phenanthridin-7-yl] trifluoromethanesulfonate.
| Compound Name | [1-(1,10-phenanthrolin-2-yl)-6-phenylbenzo[k]phenanthridin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171054802 |
| Molecular Formula | C36H20F3N3O3S |
| Molecular Weight | 631.64 g/mol |
| Exact Mass | 631.12 |
| IUPAC Name | [1-(1,10-phenanthrolin-2-yl)-6-phenylbenzo[k]phenanthridin-7-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc2ccccc2c2c1c(-c1ccccc1)nc1cccc(-c3ccc4ccc5cccnc5c4n3)c12)C(F)(F)F |
| InChI | InChI=1S/C36H20F3N3O3S/c37-36(38,39)46(43,44)45-29-20-24-10-4-5-12-25(24)31-30-26(13-6-14-28(30)42-33(32(29)31)21-8-2-1-3-9-21)27-18-17-23-16-15-22-11-7-19-40-34(22)35(23)41-27/h1-20H |
| InChIKey | XMQDZJRXZAYHEB-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.64 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|