C22H18N2O2 — CID 171059896
N-(1H-indol-4-ylmethyl)-4-phenoxybenzamide (PubChem CID 171059896) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-(1H-indol-4-ylmethyl)-4-phenoxybenzamide.
| Compound Name | N-(1H-indol-4-ylmethyl)-4-phenoxybenzamide |
|---|---|
| PubChem CID | 171059896 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-(1H-indol-4-ylmethyl)-4-phenoxybenzamide |
| SMILES | O=C(NCc1cccc2[nH]ccc12)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H18N2O2/c25-22(24-15-17-5-4-8-21-20(17)13-14-23-21)16-9-11-19(12-10-16)26-18-6-2-1-3-7-18/h1-14,23H,15H2,(H,24,25) |
| InChIKey | VZRLLQKIKQKVMH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |