C22H20BN3O4 — CID 59918704
CID 59918704 (PubChem CID 59918704) has the molecular formula C22H20BN3O4 and a molecular weight of 401.23 g/mol.
| Compound Name | CID 59918704 |
|---|---|
| PubChem CID | 59918704 |
| Molecular Formula | C22H20BN3O4 |
| Molecular Weight | 401.23 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | — |
| SMILES | [B]/C=C(\NC(=O)c1c(C)cc(C(=O)NCc2cccc3[nH]ccc23)cc1C)C(=O)O |
| InChI | InChI=1S/C22H20BN3O4/c1-12-8-15(9-13(2)19(12)21(28)26-18(10-23)22(29)30)20(27)25-11-14-4-3-5-17-16(14)6-7-24-17/h3-10,24H,11H2,1-2H3,(H,25,27)(H,26,28)(H,29,30)/b18-10- |
| InChIKey | KGPZHXFCFVKQTJ-ZDLGFXPLSA-N |
| XLogP | 2.54 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|