About hafnium;methanol;sulfate
hafnium;methanol;sulfate (PubChem CID 171061631) has the molecular formula CH4HfO5S-2
and a molecular weight of 306.60 g/mol. Its IUPAC name is hafnium;methanol;sulfate.
Molecular Properties
| Compound Name | hafnium;methanol;sulfate |
| PubChem CID | 171061631 |
| Molecular Formula | CH4HfO5S-2 |
| Molecular Weight | 306.60 g/mol |
| Exact Mass | 307.93 |
| IUPAC Name | hafnium;methanol;sulfate |
| SMILES | CO.O=S(=O)([O-])[O-].[Hf] |
| InChI | InChI=1S/CH4O.Hf.H2O4S/c1-2;;1-5(2,3)4/h2H,1H3;;(H2,1,2,3,4)/p-2 |
| InChIKey | WRPOCLRSTQXSAE-UHFFFAOYSA-L |
| XLogP | -1.73 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.60 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze hafnium;methanol;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hafnium;methanol;sulfate?
The IUPAC name of hafnium;methanol;sulfate (CID 171061631) is hafnium;methanol;sulfate.
What is the SMILES notation for hafnium;methanol;sulfate?
The canonical SMILES for hafnium;methanol;sulfate is CO.O=S(=O)([O-])[O-].[Hf].
What is the InChIKey of hafnium;methanol;sulfate?
The InChIKey is WRPOCLRSTQXSAE-UHFFFAOYSA-L. The full InChI is InChI=1S/CH4O.Hf.H2O4S/c1-2;;1-5(2,3)4/h2H,1H3;;(H2,1,2,3,4)/p-2.
What are the key properties of hafnium;methanol;sulfate?
hafnium;methanol;sulfate has a molecular weight of 306.60 g/mol, XLogP of -1.73, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hafnium;methanol;sulfate is sourced from PubChem (CID 171061631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).