About zinc;methanol;sulfate
zinc;methanol;sulfate (PubChem CID 87569846) has the molecular formula CH4O5SZn
and a molecular weight of 193.49 g/mol. Its IUPAC name is zinc;methanol;sulfate.
Molecular Properties
| Compound Name | zinc;methanol;sulfate |
| PubChem CID | 87569846 |
| Molecular Formula | CH4O5SZn |
| Molecular Weight | 193.49 g/mol |
| Exact Mass | 191.91 |
| IUPAC Name | zinc;methanol;sulfate |
| SMILES | CO.O=S(=O)([O-])[O-].[Zn+2] |
| InChI | InChI=1S/CH4O.H2O4S.Zn/c1-2;1-5(2,3)4;/h2H,1H3;(H2,1,2,3,4);/q;;+2/p-2 |
| InChIKey | KYLUDJPLCGRPEN-UHFFFAOYSA-L |
| XLogP | -1.73 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.49 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze zinc;methanol;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;methanol;sulfate?
The IUPAC name of zinc;methanol;sulfate (CID 87569846) is zinc;methanol;sulfate.
What is the SMILES notation for zinc;methanol;sulfate?
The canonical SMILES for zinc;methanol;sulfate is CO.O=S(=O)([O-])[O-].[Zn+2].
What is the InChIKey of zinc;methanol;sulfate?
The InChIKey is KYLUDJPLCGRPEN-UHFFFAOYSA-L. The full InChI is InChI=1S/CH4O.H2O4S.Zn/c1-2;1-5(2,3)4;/h2H,1H3;(H2,1,2,3,4);/q;;+2/p-2.
What are the key properties of zinc;methanol;sulfate?
zinc;methanol;sulfate has a molecular weight of 193.49 g/mol, XLogP of -1.73, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;methanol;sulfate is sourced from PubChem (CID 87569846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).