C15H15F2N3O2 — CID 171062169
(3R)-1-[6-[(3,4-difluorophenyl)methoxy]pyridazin-3-yl]pyrrolidin-3-ol (PubChem CID 171062169) has the molecular formula C15H15F2N3O2 and a molecular weight of 307.30 g/mol. Its IUPAC name is (3R)-1-[6-[(3,4-difluorophenyl)methoxy]pyridazin-3-yl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[6-[(3,4-difluorophenyl)methoxy]pyridazin-3-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 171062169 |
| Molecular Formula | C15H15F2N3O2 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (3R)-1-[6-[(3,4-difluorophenyl)methoxy]pyridazin-3-yl]pyrrolidin-3-ol |
| SMILES | O[C@@H]1CCN(c2ccc(OCc3ccc(F)c(F)c3)nn2)C1 |
| InChI | InChI=1S/C15H15F2N3O2/c16-12-2-1-10(7-13(12)17)9-22-15-4-3-14(18-19-15)20-6-5-11(21)8-20/h1-4,7,11,21H,5-6,8-9H2/t11-/m1/s1 |
| InChIKey | WLAQQNBVYUPYCW-LLVKDONJSA-N |
| XLogP | 1.90 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |