C22H20BrN3O2 — CID 171062625
2-[[3-[[2-(4-bromophenyl)acetyl]amino]phenyl]methylamino]benzamide (PubChem CID 171062625) has the molecular formula C22H20BrN3O2 and a molecular weight of 438.33 g/mol. Its IUPAC name is 2-[[3-[[2-(4-bromophenyl)acetyl]amino]phenyl]methylamino]benzamide.
| Compound Name | 2-[[3-[[2-(4-bromophenyl)acetyl]amino]phenyl]methylamino]benzamide |
|---|---|
| PubChem CID | 171062625 |
| Molecular Formula | C22H20BrN3O2 |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 2-[[3-[[2-(4-bromophenyl)acetyl]amino]phenyl]methylamino]benzamide |
| SMILES | NC(=O)c1ccccc1NCc1cccc(NC(=O)Cc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C22H20BrN3O2/c23-17-10-8-15(9-11-17)13-21(27)26-18-5-3-4-16(12-18)14-25-20-7-2-1-6-19(20)22(24)28/h1-12,25H,13-14H2,(H2,24,28)(H,26,27) |
| InChIKey | KCBFVDIJGYEXBN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |