C18H22N4O2 — CID 133468780
4-[[3-(3-methylbutanoylamino)phenyl]methylamino]pyridine-3-carboxamide (PubChem CID 133468780) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 4-[[3-(3-methylbutanoylamino)phenyl]methylamino]pyridine-3-carboxamide.
| Compound Name | 4-[[3-(3-methylbutanoylamino)phenyl]methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133468780 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 4-[[3-(3-methylbutanoylamino)phenyl]methylamino]pyridine-3-carboxamide |
| SMILES | CC(C)CC(=O)Nc1cccc(CNc2ccncc2C(N)=O)c1 |
| InChI | InChI=1S/C18H22N4O2/c1-12(2)8-17(23)22-14-5-3-4-13(9-14)10-21-16-6-7-20-11-15(16)18(19)24/h3-7,9,11-12H,8,10H2,1-2H3,(H2,19,24)(H,20,21)(H,22,23) |
| InChIKey | YNOUNTDQWQOFCF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |