C22H29ClN6O2 — CID 171062664
cis-(1S,2R)-2-[[5-chloro-4-(5,5-dimethyl-4,6-dihydropyrrolo[2,1-e]pyrazol-3-yl)-2-pyridinyl]carbamoylamino]-N-methylcyclohexane-1-carboxamide (PubChem CID 171062664) has the molecular formula C22H29ClN6O2 and a molecular weight of 444.97 g/mol. Its IUPAC name is cis-(1S,2R)-2-[[5-chloro-4-(5,5-dimethyl-4,6-dihydropyrrolo[2,1-e]pyrazol-3-yl)-2-pyridinyl]carbamoylamino]-N-methylcyclohexane-1-carboxamide.
| Compound Name | cis-(1S,2R)-2-[[5-chloro-4-(5,5-dimethyl-4,6-dihydropyrrolo[2,1-e]pyrazol-3-yl)-2-pyridinyl]carbamoylamino]-N-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 171062664 |
| Molecular Formula | C22H29ClN6O2 |
| Molecular Weight | 444.97 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | cis-(1S,2R)-2-[[5-chloro-4-(5,5-dimethyl-4,6-dihydropyrrolo[2,1-e]pyrazol-3-yl)-2-pyridinyl]carbamoylamino]-N-methylcyclohexane-1-carboxamide |
| SMILES | CNC(=O)[C@H]1CCCC[C@H]1NC(=O)Nc1cc(-c2cnn3c2CC(C)(C)C3)c(Cl)cn1 |
| InChI | InChI=1S/C22H29ClN6O2/c1-22(2)9-18-15(10-26-29(18)12-22)14-8-19(25-11-16(14)23)28-21(31)27-17-7-5-4-6-13(17)20(30)24-3/h8,10-11,13,17H,4-7,9,12H2,1-3H3,(H,24,30)(H2,25,27,28,31)/t13-,17+/m0/s1 |
| InChIKey | DMEJMYWTNYEVFX-SUMWQHHRSA-N |
| XLogP | 3.61 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.97 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |