C25H32ClN5O3 — CID 166848870
1-[2-[[(1S,3R)-3-acetamidocyclohexanecarbonyl]amino]-5-chloro-4-pyridinyl]-N,6,6-trimethyl-5,7-dihydropyrrolizine-3-carboxamide (PubChem CID 166848870) has the molecular formula C25H32ClN5O3 and a molecular weight of 486.02 g/mol. Its IUPAC name is 1-[2-[[(1S,3R)-3-acetamidocyclohexanecarbonyl]amino]-5-chloro-4-pyridinyl]-N,6,6-trimethyl-5,7-dihydropyrrolizine-3-carboxamide.
| Compound Name | 1-[2-[[(1S,3R)-3-acetamidocyclohexanecarbonyl]amino]-5-chloro-4-pyridinyl]-N,6,6-trimethyl-5,7-dihydropyrrolizine-3-carboxamide |
|---|---|
| PubChem CID | 166848870 |
| Molecular Formula | C25H32ClN5O3 |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 1-[2-[[(1S,3R)-3-acetamidocyclohexanecarbonyl]amino]-5-chloro-4-pyridinyl]-N,6,6-trimethyl-5,7-dihydropyrrolizine-3-carboxamide |
| SMILES | CNC(=O)c1cc(-c2cc(NC(=O)[C@H]3CCC[C@@H](NC(C)=O)C3)ncc2Cl)c2n1CC(C)(C)C2 |
| InChI | InChI=1S/C25H32ClN5O3/c1-14(32)29-16-7-5-6-15(8-16)23(33)30-22-10-17(19(26)12-28-22)18-9-20(24(34)27-4)31-13-25(2,3)11-21(18)31/h9-10,12,15-16H,5-8,11,13H2,1-4H3,(H,27,34)(H,29,32)(H,28,30,33)/t15-,16+/m0/s1 |
| InChIKey | BVSCCSSKSJQPFW-JKSUJKDBSA-N |
| XLogP | 3.78 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |