C21H28ClN5O3 — CID 175470657
(1R)-3-acetamido-N-[5-chloro-4-[5-(4-hydroxybutyl)-1H-pyrazol-4-yl]-2-pyridinyl]cyclohexane-1-carboxamide (PubChem CID 175470657) has the molecular formula C21H28ClN5O3 and a molecular weight of 433.94 g/mol. Its IUPAC name is (1R)-3-acetamido-N-[5-chloro-4-[5-(4-hydroxybutyl)-1H-pyrazol-4-yl]-2-pyridinyl]cyclohexane-1-carboxamide.
| Compound Name | (1R)-3-acetamido-N-[5-chloro-4-[5-(4-hydroxybutyl)-1H-pyrazol-4-yl]-2-pyridinyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 175470657 |
| Molecular Formula | C21H28ClN5O3 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (1R)-3-acetamido-N-[5-chloro-4-[5-(4-hydroxybutyl)-1H-pyrazol-4-yl]-2-pyridinyl]cyclohexane-1-carboxamide |
| SMILES | CC(=O)NC1CCC[C@@H](C(=O)Nc2cc(-c3cn[nH]c3CCCCO)c(Cl)cn2)C1 |
| InChI | InChI=1S/C21H28ClN5O3/c1-13(29)25-15-6-4-5-14(9-15)21(30)26-20-10-16(18(22)12-23-20)17-11-24-27-19(17)7-2-3-8-28/h10-12,14-15,28H,2-9H2,1H3,(H,24,27)(H,25,29)(H,23,26,30)/t14-,15?/m1/s1 |
| InChIKey | FZFPAKGNEMHQAH-GICMACPYSA-N |
| XLogP | 3.07 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|