C17H23ClIN3O3 — CID 163864981
tert-butyl N-[(1R)-3-[(5-chloro-4-iodo-2-pyridinyl)carbamoyl]cyclohexyl]carbamate (PubChem CID 163864981) has the molecular formula C17H23ClIN3O3 and a molecular weight of 479.75 g/mol. Its IUPAC name is tert-butyl N-[(1R)-3-[(5-chloro-4-iodo-2-pyridinyl)carbamoyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-3-[(5-chloro-4-iodo-2-pyridinyl)carbamoyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 163864981 |
| Molecular Formula | C17H23ClIN3O3 |
| Molecular Weight | 479.75 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | tert-butyl N-[(1R)-3-[(5-chloro-4-iodo-2-pyridinyl)carbamoyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCC(C(=O)Nc2cc(I)c(Cl)cn2)C1 |
| InChI | InChI=1S/C17H23ClIN3O3/c1-17(2,3)25-16(24)21-11-6-4-5-10(7-11)15(23)22-14-8-13(19)12(18)9-20-14/h8-11H,4-7H2,1-3H3,(H,21,24)(H,20,22,23)/t10?,11-/m1/s1 |
| InChIKey | PFWGSDKAJBSIAN-RRKGBCIJSA-N |
| XLogP | 4.36 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.75 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|