C18H28N4O4 — CID 168893976
tert-butyl N-[(1R,3S)-3-[[(4-methoxy-2-pyridinyl)amino]carbamoyl]cyclohexyl]carbamate (PubChem CID 168893976) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S)-3-[[(4-methoxy-2-pyridinyl)amino]carbamoyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S)-3-[[(4-methoxy-2-pyridinyl)amino]carbamoyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 168893976 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | tert-butyl N-[(1R,3S)-3-[[(4-methoxy-2-pyridinyl)amino]carbamoyl]cyclohexyl]carbamate |
| SMILES | COc1ccnc(NNC(=O)[C@H]2CCC[C@@H](NC(=O)OC(C)(C)C)C2)c1 |
| InChI | InChI=1S/C18H28N4O4/c1-18(2,3)26-17(24)20-13-7-5-6-12(10-13)16(23)22-21-15-11-14(25-4)8-9-19-15/h8-9,11-13H,5-7,10H2,1-4H3,(H,19,21)(H,20,24)(H,22,23)/t12-,13+/m0/s1 |
| InChIKey | OJDZXXWZWRJHND-QWHCGFSZSA-N |
| XLogP | 2.62 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|