C31H37FN6O6S — CID 171062788
tert-butyl 6-[5-fluoro-2-[2-methoxy-5-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]-3,3-dimethyl-1-oxo-4-sulfonyl-5H-isoindole-2-carboxylate (PubChem CID 171062788) has the molecular formula C31H37FN6O6S and a molecular weight of 640.74 g/mol. Its IUPAC name is tert-butyl 6-[5-fluoro-2-[2-methoxy-5-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]-3,3-dimethyl-1-oxo-4-sulfonyl-5H-isoindole-2-carboxylate.
| Compound Name | tert-butyl 6-[5-fluoro-2-[2-methoxy-5-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]-3,3-dimethyl-1-oxo-4-sulfonyl-5H-isoindole-2-carboxylate |
|---|---|
| PubChem CID | 171062788 |
| Molecular Formula | C31H37FN6O6S |
| Molecular Weight | 640.74 g/mol |
| Exact Mass | 640.25 |
| IUPAC Name | tert-butyl 6-[5-fluoro-2-[2-methoxy-5-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]-3,3-dimethyl-1-oxo-4-sulfonyl-5H-isoindole-2-carboxylate |
| SMILES | COc1ccc(N2CCN(C)CC2)cc1Nc1ncc(F)c(C2=CC3=C(C(=S(=O)=O)C2)C(C)(C)N(C(=O)OC(C)(C)C)C3=O)n1 |
| InChI | InChI=1S/C31H37FN6O6S/c1-30(2,3)44-29(40)38-27(39)20-14-18(15-24(45(41)42)25(20)31(38,4)5)26-21(32)17-33-28(35-26)34-22-16-19(8-9-23(22)43-7)37-12-10-36(6)11-13-37/h8-9,14,16-17H,10-13,15H2,1-7H3,(H,33,34,35) |
| InChIKey | OBVTWPAZOLTERN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.74 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|