C12H12BrF2NO — CID 171063550
(1R,4R)-5-[(4-bromo-2,3-difluorophenyl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane (PubChem CID 171063550) has the molecular formula C12H12BrF2NO and a molecular weight of 304.13 g/mol. Its IUPAC name is (1R,4R)-5-[(4-bromo-2,3-difluorophenyl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,4R)-5-[(4-bromo-2,3-difluorophenyl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 171063550 |
| Molecular Formula | C12H12BrF2NO |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | (1R,4R)-5-[(4-bromo-2,3-difluorophenyl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane |
| SMILES | Fc1c(Br)ccc(CN2C[C@H]3C[C@@H]2CO3)c1F |
| InChI | InChI=1S/C12H12BrF2NO/c13-10-2-1-7(11(14)12(10)15)4-16-5-9-3-8(16)6-17-9/h1-2,8-9H,3-6H2/t8-,9-/m1/s1 |
| InChIKey | SQSITGWCWAQKAT-RKDXNWHRSA-N |
| XLogP | 2.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|