C22H28ClNO3 — CID 171066062
tert-butyl N-[(3-chloro-4-phenylphenyl)methyl]-N-(4-hydroxybutyl)carbamate (PubChem CID 171066062) has the molecular formula C22H28ClNO3 and a molecular weight of 389.92 g/mol. Its IUPAC name is tert-butyl N-[(3-chloro-4-phenylphenyl)methyl]-N-(4-hydroxybutyl)carbamate.
| Compound Name | tert-butyl N-[(3-chloro-4-phenylphenyl)methyl]-N-(4-hydroxybutyl)carbamate |
|---|---|
| PubChem CID | 171066062 |
| Molecular Formula | C22H28ClNO3 |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | tert-butyl N-[(3-chloro-4-phenylphenyl)methyl]-N-(4-hydroxybutyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCCO)Cc1ccc(-c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C22H28ClNO3/c1-22(2,3)27-21(26)24(13-7-8-14-25)16-17-11-12-19(20(23)15-17)18-9-5-4-6-10-18/h4-6,9-12,15,25H,7-8,13-14,16H2,1-3H3 |
| InChIKey | BXGNBCDVUZYZCT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|