About ethane;N'-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]-N'-propylethane-1,2-diamine
ethane;N'-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]-N'-propylethane-1,2-diamine (PubChem CID 171069581) has the molecular formula C19H36N4
and a molecular weight of 320.53 g/mol. Its IUPAC name is ethane;N'-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]-N'-propylethane-1,2-diamine.
Molecular Properties
| Compound Name | ethane;N'-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]-N'-propylethane-1,2-diamine |
| PubChem CID | 171069581 |
| Molecular Formula | C19H36N4 |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 320.29 |
| IUPAC Name | ethane;N'-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]-N'-propylethane-1,2-diamine |
| SMILES | CC.CCCN(CCN)CC1CCN(c2ccc(C)cn2)CC1 |
| InChI | InChI=1S/C17H30N4.C2H6/c1-3-9-20(12-8-18)14-16-6-10-21(11-7-16)17-5-4-15(2)13-19-17;1-2/h4-5,13,16H,3,6-12,14,18H2,1-2H3;1-2H3 |
| InChIKey | IJNHRSHDOYKTSW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;N'-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]-N'-propylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N'-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]-N'-propylethane-1,2-diamine?
The IUPAC name of ethane;N'-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]-N'-propylethane-1,2-diamine (CID 171069581) is ethane;N'-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]-N'-propylethane-1,2-diamine.
What is the SMILES notation for ethane;N'-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]-N'-propylethane-1,2-diamine?
The canonical SMILES for ethane;N'-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]-N'-propylethane-1,2-diamine is CC.CCCN(CCN)CC1CCN(c2ccc(C)cn2)CC1.
What is the InChIKey of ethane;N'-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]-N'-propylethane-1,2-diamine?
The InChIKey is IJNHRSHDOYKTSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N4.C2H6/c1-3-9-20(12-8-18)14-16-6-10-21(11-7-16)17-5-4-15(2)13-19-17;1-2/h4-5,13,16H,3,6-12,14,18H2,1-2H3;1-2H3.
What are the key properties of ethane;N'-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]-N'-propylethane-1,2-diamine?
ethane;N'-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]-N'-propylethane-1,2-diamine has a molecular weight of 320.53 g/mol, XLogP of 3.30, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N'-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]-N'-propylethane-1,2-diamine is sourced from PubChem (CID 171069581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).