C21H37N3 — CID 171069804
butane;1-[(1-methylpiperidin-4-yl)methyl]-4-phenylpiperazine (PubChem CID 171069804) has the molecular formula C21H37N3 and a molecular weight of 331.55 g/mol. Its IUPAC name is butane;1-[(1-methylpiperidin-4-yl)methyl]-4-phenylpiperazine.
| Compound Name | butane;1-[(1-methylpiperidin-4-yl)methyl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 171069804 |
| Molecular Formula | C21H37N3 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.30 |
| IUPAC Name | butane;1-[(1-methylpiperidin-4-yl)methyl]-4-phenylpiperazine |
| SMILES | CCCC.CN1CCC(CN2CCN(c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C17H27N3.C4H10/c1-18-9-7-16(8-10-18)15-19-11-13-20(14-12-19)17-5-3-2-4-6-17;1-3-4-2/h2-6,16H,7-15H2,1H3;3-4H2,1-2H3 |
| InChIKey | QISQPFDTKCTZCQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |