C27H40N6O4 — CID 171070471
2-[1-[7-[[6-(4,4-dimethoxybutoxy)-3-pyridinyl]methylamino]-3-ethylpyrazolo[1,5-a]pyrimidin-5-yl]piperidin-2-yl]ethanol (PubChem CID 171070471) has the molecular formula C27H40N6O4 and a molecular weight of 512.66 g/mol. Its IUPAC name is 2-[1-[7-[[6-(4,4-dimethoxybutoxy)-3-pyridinyl]methylamino]-3-ethylpyrazolo[1,5-a]pyrimidin-5-yl]piperidin-2-yl]ethanol.
| Compound Name | 2-[1-[7-[[6-(4,4-dimethoxybutoxy)-3-pyridinyl]methylamino]-3-ethylpyrazolo[1,5-a]pyrimidin-5-yl]piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 171070471 |
| Molecular Formula | C27H40N6O4 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | 2-[1-[7-[[6-(4,4-dimethoxybutoxy)-3-pyridinyl]methylamino]-3-ethylpyrazolo[1,5-a]pyrimidin-5-yl]piperidin-2-yl]ethanol |
| SMILES | CCc1cnn2c(NCc3ccc(OCCCC(OC)OC)nc3)cc(N3CCCCC3CCO)nc12 |
| InChI | InChI=1S/C27H40N6O4/c1-4-21-19-30-33-23(16-24(31-27(21)33)32-13-6-5-8-22(32)12-14-34)28-17-20-10-11-25(29-18-20)37-15-7-9-26(35-2)36-3/h10-11,16,18-19,22,26,28,34H,4-9,12-15,17H2,1-3H3 |
| InChIKey | OUDVMYBMFUBWQM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 106.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|