C22H31N6O2+ — CID 144762830
3-ethyl-N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-5-[(2S)-2-(2-methoxyethyl)piperidin-1-yl]pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 144762830) has the molecular formula C22H31N6O2+ and a molecular weight of 411.53 g/mol. Its IUPAC name is 3-ethyl-N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-5-[(2S)-2-(2-methoxyethyl)piperidin-1-yl]pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 3-ethyl-N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-5-[(2S)-2-(2-methoxyethyl)piperidin-1-yl]pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 144762830 |
| Molecular Formula | C22H31N6O2+ |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 3-ethyl-N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-5-[(2S)-2-(2-methoxyethyl)piperidin-1-yl]pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCc1cnn2c(NCc3ccc[n+](O)c3)cc(N3CCCC[C@H]3CCOC)nc12 |
| InChI | InChI=1S/C22H31N6O2/c1-3-18-15-24-28-20(23-14-17-7-6-10-26(29)16-17)13-21(25-22(18)28)27-11-5-4-8-19(27)9-12-30-2/h6-7,10,13,15-16,19,23,29H,3-5,8-9,11-12,14H2,1-2H3/q+1/t19-/m0/s1 |
| InChIKey | MVBMNMSTQXTHMD-IBGZPJMESA-N |
| XLogP | 2.82 |
| TPSA | 78.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|