C20H26BN6O — CID 71148289
CID 71148289 (PubChem CID 71148289) has the molecular formula C20H26BN6O and a molecular weight of 377.28 g/mol.
| Compound Name | CID 71148289 |
|---|---|
| PubChem CID | 71148289 |
| Molecular Formula | C20H26BN6O |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | — |
| SMILES | C[B]c1cnn2c(NCc3cccnc3)cc(N3CCCC[C@H]3CCO)nc12 |
| InChI | InChI=1S/C20H26BN6O/c1-21-17-14-24-27-18(23-13-15-5-4-8-22-12-15)11-19(25-20(17)27)26-9-3-2-6-16(26)7-10-28/h4-5,8,11-12,14,16,23,28H,2-3,6-7,9-10,13H2,1H3/t16-/m0/s1 |
| InChIKey | MPEVXUNMGHDXPN-INIZCTEOSA-N |
| XLogP | 1.86 |
| TPSA | 78.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|