C24H29BN6O2 — CID 89298178
CID 89298178 (PubChem CID 89298178) has the molecular formula C24H29BN6O2 and a molecular weight of 444.35 g/mol.
| Compound Name | CID 89298178 |
|---|---|
| PubChem CID | 89298178 |
| Molecular Formula | C24H29BN6O2 |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3ccc(NC(=O)C4CC4)cc3)cc(N3CCCC[C@H]3CCO)nc12 |
| InChI | InChI=1S/C24H29BN6O2/c25-20-15-27-31-21(13-22(29-23(20)31)30-11-2-1-3-19(30)10-12-32)26-14-16-4-8-18(9-5-16)28-24(33)17-6-7-17/h4-5,8-9,13,15,17,19,26,32H,1-3,6-7,10-12,14H2,(H,28,33)/t19-/m0/s1 |
| InChIKey | PWJWQCLHYCGHNX-IBGZPJMESA-N |
| XLogP | 2.22 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|