C25H25BN6O — CID 89365717
CID 89365717 (PubChem CID 89365717) has the molecular formula C25H25BN6O and a molecular weight of 436.33 g/mol.
| Compound Name | CID 89365717 |
|---|---|
| PubChem CID | 89365717 |
| Molecular Formula | C25H25BN6O |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3cccc(NC(=O)C4CCCC4)c3)cc(-c3ccccc3N)nc12 |
| InChI | InChI=1S/C25H25BN6O/c26-20-15-29-32-23(13-22(31-24(20)32)19-10-3-4-11-21(19)27)28-14-16-6-5-9-18(12-16)30-25(33)17-7-1-2-8-17/h3-6,9-13,15,17,28H,1-2,7-8,14,27H2,(H,30,33) |
| InChIKey | GFWKWWBGIBKYMG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|