C27H19BN6O2 — CID 136620094
CID 136620094 (PubChem CID 136620094) has the molecular formula C27H19BN6O2 and a molecular weight of 470.30 g/mol.
| Compound Name | CID 136620094 |
|---|---|
| PubChem CID | 136620094 |
| Molecular Formula | C27H19BN6O2 |
| Molecular Weight | 470.30 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3cccc(NC(=O)c4ccc(C#N)cc4)c3)cc(-c3ccccc3O)nc12 |
| InChI | InChI=1S/C27H19BN6O2/c28-22-16-31-34-25(13-23(33-26(22)34)21-6-1-2-7-24(21)35)30-15-18-4-3-5-20(12-18)32-27(36)19-10-8-17(14-29)9-11-19/h1-13,16,30,35H,15H2,(H,32,36) |
| InChIKey | UIVCLUJWDFSXDC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|