C14H15BN5 — CID 70878905
CID 70878905 (PubChem CID 70878905) has the molecular formula C14H15BN5 and a molecular weight of 264.12 g/mol.
| Compound Name | CID 70878905 |
|---|---|
| PubChem CID | 70878905 |
| Molecular Formula | C14H15BN5 |
| Molecular Weight | 264.12 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | — |
| SMILES | C[B]c1cnn2c(NCc3cccnc3)cc(C)nc12 |
| InChI | InChI=1S/C14H15BN5/c1-10-6-13(17-8-11-4-3-5-16-7-11)20-14(19-10)12(15-2)9-18-20/h3-7,9,17H,8H2,1-2H3 |
| InChIKey | KZLZLYDQXZSMQP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.12 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|