C20H42N2 — CID 171070532
1-[(E)-but-2-en-2-yl]-4-propylpiperazine;ethane;2-methylbuta-1,3-diene (PubChem CID 171070532) has the molecular formula C20H42N2 and a molecular weight of 310.57 g/mol. Its IUPAC name is 1-[(E)-but-2-en-2-yl]-4-propylpiperazine;ethane;2-methylbuta-1,3-diene.
| Compound Name | 1-[(E)-but-2-en-2-yl]-4-propylpiperazine;ethane;2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 171070532 |
| Molecular Formula | C20H42N2 |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.33 |
| IUPAC Name | 1-[(E)-but-2-en-2-yl]-4-propylpiperazine;ethane;2-methylbuta-1,3-diene |
| SMILES | C/C=C(\C)N1CCN(CCC)CC1.C=CC(=C)C.CC.CC |
| InChI | InChI=1S/C11H22N2.C5H8.2C2H6/c1-4-6-12-7-9-13(10-8-12)11(3)5-2;1-4-5(2)3;2*1-2/h5H,4,6-10H2,1-3H3;4H,1-2H2,3H3;2*1-2H3/b11-5+;;; |
| InChIKey | YNTXPPSGXLTOCQ-WVYPJBOLSA-N |
| XLogP | 5.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|