C19H42N4O — CID 171070832
ethane;N-[3-[4-[3-[methyl(propan-2-yl)amino]propyl]piperazin-1-yl]propyl]propanamide (PubChem CID 171070832) has the molecular formula C19H42N4O and a molecular weight of 342.57 g/mol. Its IUPAC name is ethane;N-[3-[4-[3-[methyl(propan-2-yl)amino]propyl]piperazin-1-yl]propyl]propanamide.
| Compound Name | ethane;N-[3-[4-[3-[methyl(propan-2-yl)amino]propyl]piperazin-1-yl]propyl]propanamide |
|---|---|
| PubChem CID | 171070832 |
| Molecular Formula | C19H42N4O |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.34 |
| IUPAC Name | ethane;N-[3-[4-[3-[methyl(propan-2-yl)amino]propyl]piperazin-1-yl]propyl]propanamide |
| SMILES | CC.CCC(=O)NCCCN1CCN(CCCN(C)C(C)C)CC1 |
| InChI | InChI=1S/C17H36N4O.C2H6/c1-5-17(22)18-8-6-10-20-12-14-21(15-13-20)11-7-9-19(4)16(2)3;1-2/h16H,5-15H2,1-4H3,(H,18,22);1-2H3 |
| InChIKey | FIPXXOBIYJFLDV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|