About 2-methylpropyl 4-(4-propan-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate
2-methylpropyl 4-(4-propan-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate (PubChem CID 171072871) has the molecular formula C19H34N2O4
and a molecular weight of 354.49 g/mol. Its IUPAC name is 2-methylpropyl 4-(4-propan-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropyl 4-(4-propan-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate |
| PubChem CID | 171072871 |
| Molecular Formula | C19H34N2O4 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 2-methylpropyl 4-(4-propan-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCC(C(=O)N2CCC(OC(C)C)CC2)CC1 |
| InChI | InChI=1S/C19H34N2O4/c1-14(2)13-24-19(23)21-9-5-16(6-10-21)18(22)20-11-7-17(8-12-20)25-15(3)4/h14-17H,5-13H2,1-4H3 |
| InChIKey | CHPPSEUWZMOUIJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpropyl 4-(4-propan-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 4-(4-propan-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate?
The IUPAC name of 2-methylpropyl 4-(4-propan-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate (CID 171072871) is 2-methylpropyl 4-(4-propan-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate.
What is the SMILES notation for 2-methylpropyl 4-(4-propan-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate?
The canonical SMILES for 2-methylpropyl 4-(4-propan-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate is CC(C)COC(=O)N1CCC(C(=O)N2CCC(OC(C)C)CC2)CC1.
What is the InChIKey of 2-methylpropyl 4-(4-propan-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate?
The InChIKey is CHPPSEUWZMOUIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34N2O4/c1-14(2)13-24-19(23)21-9-5-16(6-10-21)18(22)20-11-7-17(8-12-20)25-15(3)4/h14-17H,5-13H2,1-4H3.
What are the key properties of 2-methylpropyl 4-(4-propan-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate?
2-methylpropyl 4-(4-propan-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate has a molecular weight of 354.49 g/mol, XLogP of 2.91, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 4-(4-propan-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate is sourced from PubChem (CID 171072871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).