C15H28N2O4S — CID 110725414
(1-methylsulfonylpiperidin-4-yl)-(4-propan-2-yloxypiperidin-1-yl)methanone (PubChem CID 110725414) has the molecular formula C15H28N2O4S and a molecular weight of 332.47 g/mol. Its IUPAC name is (1-methylsulfonylpiperidin-4-yl)-(4-propan-2-yloxypiperidin-1-yl)methanone.
| Compound Name | (1-methylsulfonylpiperidin-4-yl)-(4-propan-2-yloxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 110725414 |
| Molecular Formula | C15H28N2O4S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (1-methylsulfonylpiperidin-4-yl)-(4-propan-2-yloxypiperidin-1-yl)methanone |
| SMILES | CC(C)OC1CCN(C(=O)C2CCN(S(C)(=O)=O)CC2)CC1 |
| InChI | InChI=1S/C15H28N2O4S/c1-12(2)21-14-6-8-16(9-7-14)15(18)13-4-10-17(11-5-13)22(3,19)20/h12-14H,4-11H2,1-3H3 |
| InChIKey | WYALMXRKSMVTHT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |