About ethane;2-methylpropyl 4-[(1-acetylpiperidin-4-yl)methyl]piperidine-1-carboxylate
ethane;2-methylpropyl 4-[(1-acetylpiperidin-4-yl)methyl]piperidine-1-carboxylate (PubChem CID 171073059) has the molecular formula C20H38N2O3
and a molecular weight of 354.54 g/mol. Its IUPAC name is ethane;2-methylpropyl 4-[(1-acetylpiperidin-4-yl)methyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethane;2-methylpropyl 4-[(1-acetylpiperidin-4-yl)methyl]piperidine-1-carboxylate |
| PubChem CID | 171073059 |
| Molecular Formula | C20H38N2O3 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | ethane;2-methylpropyl 4-[(1-acetylpiperidin-4-yl)methyl]piperidine-1-carboxylate |
| SMILES | CC.CC(=O)N1CCC(CC2CCN(C(=O)OCC(C)C)CC2)CC1 |
| InChI | InChI=1S/C18H32N2O3.C2H6/c1-14(2)13-23-18(22)20-10-6-17(7-11-20)12-16-4-8-19(9-5-16)15(3)21;1-2/h14,16-17H,4-13H2,1-3H3;1-2H3 |
| InChIKey | IUEZLNFTFDZRIX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-methylpropyl 4-[(1-acetylpiperidin-4-yl)methyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpropyl 4-[(1-acetylpiperidin-4-yl)methyl]piperidine-1-carboxylate?
The IUPAC name of ethane;2-methylpropyl 4-[(1-acetylpiperidin-4-yl)methyl]piperidine-1-carboxylate (CID 171073059) is ethane;2-methylpropyl 4-[(1-acetylpiperidin-4-yl)methyl]piperidine-1-carboxylate.
What is the SMILES notation for ethane;2-methylpropyl 4-[(1-acetylpiperidin-4-yl)methyl]piperidine-1-carboxylate?
The canonical SMILES for ethane;2-methylpropyl 4-[(1-acetylpiperidin-4-yl)methyl]piperidine-1-carboxylate is CC.CC(=O)N1CCC(CC2CCN(C(=O)OCC(C)C)CC2)CC1.
What is the InChIKey of ethane;2-methylpropyl 4-[(1-acetylpiperidin-4-yl)methyl]piperidine-1-carboxylate?
The InChIKey is IUEZLNFTFDZRIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2O3.C2H6/c1-14(2)13-23-18(22)20-10-6-17(7-11-20)12-16-4-8-19(9-5-16)15(3)21;1-2/h14,16-17H,4-13H2,1-3H3;1-2H3.
What are the key properties of ethane;2-methylpropyl 4-[(1-acetylpiperidin-4-yl)methyl]piperidine-1-carboxylate?
ethane;2-methylpropyl 4-[(1-acetylpiperidin-4-yl)methyl]piperidine-1-carboxylate has a molecular weight of 354.54 g/mol, XLogP of 4.17, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpropyl 4-[(1-acetylpiperidin-4-yl)methyl]piperidine-1-carboxylate is sourced from PubChem (CID 171073059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).