About ethane;2-methylpropyl 4-[(4-methylpiperazin-1-yl)methyl]piperidine-1-carboxylate
ethane;2-methylpropyl 4-[(4-methylpiperazin-1-yl)methyl]piperidine-1-carboxylate (PubChem CID 171073017) has the molecular formula C18H37N3O2
and a molecular weight of 327.51 g/mol. Its IUPAC name is ethane;2-methylpropyl 4-[(4-methylpiperazin-1-yl)methyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethane;2-methylpropyl 4-[(4-methylpiperazin-1-yl)methyl]piperidine-1-carboxylate |
| PubChem CID | 171073017 |
| Molecular Formula | C18H37N3O2 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | ethane;2-methylpropyl 4-[(4-methylpiperazin-1-yl)methyl]piperidine-1-carboxylate |
| SMILES | CC.CC(C)COC(=O)N1CCC(CN2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C16H31N3O2.C2H6/c1-14(2)13-21-16(20)19-6-4-15(5-7-19)12-18-10-8-17(3)9-11-18;1-2/h14-15H,4-13H2,1-3H3;1-2H3 |
| InChIKey | KEXOGPXZFUNODD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;2-methylpropyl 4-[(4-methylpiperazin-1-yl)methyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpropyl 4-[(4-methylpiperazin-1-yl)methyl]piperidine-1-carboxylate?
The IUPAC name of ethane;2-methylpropyl 4-[(4-methylpiperazin-1-yl)methyl]piperidine-1-carboxylate (CID 171073017) is ethane;2-methylpropyl 4-[(4-methylpiperazin-1-yl)methyl]piperidine-1-carboxylate.
What is the SMILES notation for ethane;2-methylpropyl 4-[(4-methylpiperazin-1-yl)methyl]piperidine-1-carboxylate?
The canonical SMILES for ethane;2-methylpropyl 4-[(4-methylpiperazin-1-yl)methyl]piperidine-1-carboxylate is CC.CC(C)COC(=O)N1CCC(CN2CCN(C)CC2)CC1.
What is the InChIKey of ethane;2-methylpropyl 4-[(4-methylpiperazin-1-yl)methyl]piperidine-1-carboxylate?
The InChIKey is KEXOGPXZFUNODD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N3O2.C2H6/c1-14(2)13-21-16(20)19-6-4-15(5-7-19)12-18-10-8-17(3)9-11-18;1-2/h14-15H,4-13H2,1-3H3;1-2H3.
What are the key properties of ethane;2-methylpropyl 4-[(4-methylpiperazin-1-yl)methyl]piperidine-1-carboxylate?
ethane;2-methylpropyl 4-[(4-methylpiperazin-1-yl)methyl]piperidine-1-carboxylate has a molecular weight of 327.51 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpropyl 4-[(4-methylpiperazin-1-yl)methyl]piperidine-1-carboxylate is sourced from PubChem (CID 171073017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).