C26H27N9O2 — CID 171074759
6-[1-[1-[(2E,4Z)-5-amino-2-cyano-4-(methyliminomethyl)penta-2,4-dienoyl]piperidin-4-yl]-5-methylpyrazol-4-yl]-4-methoxypyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 171074759) has the molecular formula C26H27N9O2 and a molecular weight of 497.56 g/mol. Its IUPAC name is 6-[1-[1-[(2E,4Z)-5-amino-2-cyano-4-(methyliminomethyl)penta-2,4-dienoyl]piperidin-4-yl]-5-methylpyrazol-4-yl]-4-methoxypyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 6-[1-[1-[(2E,4Z)-5-amino-2-cyano-4-(methyliminomethyl)penta-2,4-dienoyl]piperidin-4-yl]-5-methylpyrazol-4-yl]-4-methoxypyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171074759 |
| Molecular Formula | C26H27N9O2 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 6-[1-[1-[(2E,4Z)-5-amino-2-cyano-4-(methyliminomethyl)penta-2,4-dienoyl]piperidin-4-yl]-5-methylpyrazol-4-yl]-4-methoxypyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | C/N=C/C(=C\N)/C=C(\C#N)C(=O)N1CCC(n2ncc(-c3cc(OC)c4c(C#N)cnn4c3)c2C)CC1 |
| InChI | InChI=1S/C26H27N9O2/c1-17-23(20-9-24(37-3)25-21(12-29)14-31-34(25)16-20)15-32-35(17)22-4-6-33(7-5-22)26(36)19(11-28)8-18(10-27)13-30-2/h8-10,13-16,22H,4-7,27H2,1-3H3/b18-10-,19-8+,30-13+ |
| InChIKey | UVPVFMHHVFXMOL-JBMIEDOOSA-N |
| XLogP | 2.54 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|