C28H29N7O3 — CID 171074797
6-[1-[1-[(E)-2-cyano-4-(oxan-4-ylidene)but-2-enoyl]piperidin-4-yl]-5-methylpyrazol-4-yl]-4-methoxypyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 171074797) has the molecular formula C28H29N7O3 and a molecular weight of 511.59 g/mol. Its IUPAC name is 6-[1-[1-[(E)-2-cyano-4-(oxan-4-ylidene)but-2-enoyl]piperidin-4-yl]-5-methylpyrazol-4-yl]-4-methoxypyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 6-[1-[1-[(E)-2-cyano-4-(oxan-4-ylidene)but-2-enoyl]piperidin-4-yl]-5-methylpyrazol-4-yl]-4-methoxypyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171074797 |
| Molecular Formula | C28H29N7O3 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 6-[1-[1-[(E)-2-cyano-4-(oxan-4-ylidene)but-2-enoyl]piperidin-4-yl]-5-methylpyrazol-4-yl]-4-methoxypyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | COc1cc(-c2cnn(C3CCN(C(=O)/C(C#N)=C/C=C4CCOCC4)CC3)c2C)cn2ncc(C#N)c12 |
| InChI | InChI=1S/C28H29N7O3/c1-19-25(22-13-26(37-2)27-23(15-30)16-31-34(27)18-22)17-32-35(19)24-5-9-33(10-6-24)28(36)21(14-29)4-3-20-7-11-38-12-8-20/h3-4,13,16-18,24H,5-12H2,1-2H3/b21-4+ |
| InChIKey | GQZATDLDTCHRBP-IPBDZQFASA-N |
| XLogP | 3.74 |
| TPSA | 121.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|