C21H19N5O3 — CID 171075210
3-[6-(3-cyclohexa-2,4-dien-1-yltriazol-4-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171075210) has the molecular formula C21H19N5O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is 3-[6-(3-cyclohexa-2,4-dien-1-yltriazol-4-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(3-cyclohexa-2,4-dien-1-yltriazol-4-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171075210 |
| Molecular Formula | C21H19N5O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 3-[6-(3-cyclohexa-2,4-dien-1-yltriazol-4-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(-c4cnnn4C4C=CC=CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H19N5O3/c27-19-9-8-17(20(28)23-19)25-12-14-10-13(6-7-16(14)21(25)29)18-11-22-24-26(18)15-4-2-1-3-5-15/h1-4,6-7,10-11,15,17H,5,8-9,12H2,(H,23,27,28) |
| InChIKey | CRXZKCDKTVBVIN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|