C14H19F2IO2S — CID 171076213
(4,4-difluoro-3,3-dimethyl-5-phenylmethoxypentoxy) thiohypoiodite (PubChem CID 171076213) has the molecular formula C14H19F2IO2S and a molecular weight of 416.27 g/mol. Its IUPAC name is (4,4-difluoro-3,3-dimethyl-5-phenylmethoxypentoxy) thiohypoiodite.
| Compound Name | (4,4-difluoro-3,3-dimethyl-5-phenylmethoxypentoxy) thiohypoiodite |
|---|---|
| PubChem CID | 171076213 |
| Molecular Formula | C14H19F2IO2S |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | (4,4-difluoro-3,3-dimethyl-5-phenylmethoxypentoxy) thiohypoiodite |
| SMILES | CC(C)(CCOSI)C(F)(F)COCc1ccccc1 |
| InChI | InChI=1S/C14H19F2IO2S/c1-13(2,8-9-19-20-17)14(15,16)11-18-10-12-6-4-3-5-7-12/h3-7H,8-11H2,1-2H3 |
| InChIKey | ZYGIVSWINDDGNW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|